C24H31NO7S — CID 139854739
[2-(4-methylphenyl)sulfonyloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutyl] acetate (PubChem CID 139854739) has the molecular formula C24H31NO7S and a molecular weight of 477.58 g/mol. Its IUPAC name is [2-(4-methylphenyl)sulfonyloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutyl] acetate.
| Compound Name | [2-(4-methylphenyl)sulfonyloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutyl] acetate |
|---|---|
| PubChem CID | 139854739 |
| Molecular Formula | C24H31NO7S |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | [2-(4-methylphenyl)sulfonyloxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutyl] acetate |
| SMILES | CC(=O)OCC(OS(=O)(=O)c1ccc(C)cc1)C(Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H31NO7S/c1-17-11-13-20(14-12-17)33(28,29)32-22(16-30-18(2)26)21(15-19-9-7-6-8-10-19)25-23(27)31-24(3,4)5/h6-14,21-22H,15-16H2,1-5H3,(H,25,27) |
| InChIKey | AUQLFRXKHORMMR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|