C29H40N2O9S — CID 58462446
tert-butyl (2S,4R)-4-(4-methylphenyl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 58462446) has the molecular formula C29H40N2O9S and a molecular weight of 592.71 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-(4-methylphenyl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | tert-butyl (2S,4R)-4-(4-methylphenyl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 58462446 |
| Molecular Formula | C29H40N2O9S |
| Molecular Weight | 592.71 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | tert-butyl (2S,4R)-4-(4-methylphenyl)sulfonyloxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H](CNC(=O)OCc2ccccc2)C[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H40N2O9S/c1-20-13-15-23(16-14-20)41(35,36)40-22(18-30-26(33)37-19-21-11-9-8-10-12-21)17-24(25(32)38-28(2,3)4)31-27(34)39-29(5,6)7/h8-16,22,24H,17-19H2,1-7H3,(H,30,33)(H,31,34)/t22-,24+/m1/s1 |
| InChIKey | MVXQTPXACRQQJW-VWNXMTODSA-N |
| XLogP | 4.62 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.71 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|