C22H36N2O7S — CID 121265087
1,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentan-3-yl 4-methylbenzenesulfonate (PubChem CID 121265087) has the molecular formula C22H36N2O7S and a molecular weight of 472.60 g/mol. Its IUPAC name is 1,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentan-3-yl 4-methylbenzenesulfonate.
| Compound Name | 1,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentan-3-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 121265087 |
| Molecular Formula | C22H36N2O7S |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 1,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentan-3-yl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(CCNC(=O)OC(C)(C)C)CCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H36N2O7S/c1-16-8-10-18(11-9-16)32(27,28)31-17(12-14-23-19(25)29-21(2,3)4)13-15-24-20(26)30-22(5,6)7/h8-11,17H,12-15H2,1-7H3,(H,23,25)(H,24,26) |
| InChIKey | LALGOHQPEFLNPJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|