C14H21NO5S — CID 89368645
[1,1,2,2-tetradeuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] 4-methylbenzenesulfonate (PubChem CID 89368645) has the molecular formula C14H21NO5S and a molecular weight of 319.42 g/mol. Its IUPAC name is [1,1,2,2-tetradeuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] 4-methylbenzenesulfonate.
| Compound Name | [1,1,2,2-tetradeuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89368645 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | [1,1,2,2-tetradeuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] 4-methylbenzenesulfonate |
| SMILES | [2H]C([2H])(NC(=O)OC(C)(C)C)C([2H])([2H])OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H21NO5S/c1-11-5-7-12(8-6-11)21(17,18)19-10-9-15-13(16)20-14(2,3)4/h5-8H,9-10H2,1-4H3,(H,15,16)/i9D2,10D2 |
| InChIKey | OWNIGLWHXOENAA-YQUBHJMPSA-N |
| XLogP | 2.23 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|