C13H18O5S — CID 11266149
tert-butyl 2-(4-methylphenyl)sulfonyloxyacetate (PubChem CID 11266149) has the molecular formula C13H18O5S and a molecular weight of 286.35 g/mol. Its IUPAC name is tert-butyl 2-(4-methylphenyl)sulfonyloxyacetate.
| Compound Name | tert-butyl 2-(4-methylphenyl)sulfonyloxyacetate |
|---|---|
| PubChem CID | 11266149 |
| Molecular Formula | C13H18O5S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | tert-butyl 2-(4-methylphenyl)sulfonyloxyacetate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C13H18O5S/c1-10-5-7-11(8-6-10)19(15,16)17-9-12(14)18-13(2,3)4/h5-8H,9H2,1-4H3 |
| InChIKey | MNEZBXTZLVGVNY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|