C20H30O6S — CID 166525082
tert-butyl 2-[2-[1-[2-(4-methylphenyl)sulfonyloxyethyl]cyclopropyl]ethoxy]acetate (PubChem CID 166525082) has the molecular formula C20H30O6S and a molecular weight of 398.52 g/mol. Its IUPAC name is tert-butyl 2-[2-[1-[2-(4-methylphenyl)sulfonyloxyethyl]cyclopropyl]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[1-[2-(4-methylphenyl)sulfonyloxyethyl]cyclopropyl]ethoxy]acetate |
|---|---|
| PubChem CID | 166525082 |
| Molecular Formula | C20H30O6S |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | tert-butyl 2-[2-[1-[2-(4-methylphenyl)sulfonyloxyethyl]cyclopropyl]ethoxy]acetate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC2(CCOCC(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H30O6S/c1-16-5-7-17(8-6-16)27(22,23)25-14-12-20(9-10-20)11-13-24-15-18(21)26-19(2,3)4/h5-8H,9-15H2,1-4H3 |
| InChIKey | QPNJJAUSXRBVFF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|