C20H30O8S — CID 123207456
tert-butyl 2-[2-[2-[2-[(4-methylphenyl)-oxo-(oxomethylidene)-λ6-sulfanyl]oxyethoxy]ethoxy]ethoxy]acetate (PubChem CID 123207456) has the molecular formula C20H30O8S and a molecular weight of 430.52 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[2-[(4-methylphenyl)-oxo-(oxomethylidene)-λ6-sulfanyl]oxyethoxy]ethoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-[2-[(4-methylphenyl)-oxo-(oxomethylidene)-λ6-sulfanyl]oxyethoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 123207456 |
| Molecular Formula | C20H30O8S |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | tert-butyl 2-[2-[2-[2-[(4-methylphenyl)-oxo-(oxomethylidene)-λ6-sulfanyl]oxyethoxy]ethoxy]ethoxy]acetate |
| SMILES | Cc1ccc(S(=O)(=C=O)OCCOCCOCCOCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H30O8S/c1-17-5-7-18(8-6-17)29(23,16-21)27-14-13-25-10-9-24-11-12-26-15-19(22)28-20(2,3)4/h5-8H,9-15H2,1-4H3 |
| InChIKey | HWWZVMLEMKGWJN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|