C21H34O9S — CID 153375811
tert-butyl 2-[2-[2-[2-(2-benzylsulfonyloxyethoxy)ethoxy]ethoxy]ethoxy]acetate (PubChem CID 153375811) has the molecular formula C21H34O9S and a molecular weight of 462.56 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[2-(2-benzylsulfonyloxyethoxy)ethoxy]ethoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-[2-(2-benzylsulfonyloxyethoxy)ethoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 153375811 |
| Molecular Formula | C21H34O9S |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | tert-butyl 2-[2-[2-[2-(2-benzylsulfonyloxyethoxy)ethoxy]ethoxy]ethoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCCOS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C21H34O9S/c1-21(2,3)30-20(22)17-28-14-13-26-10-9-25-11-12-27-15-16-29-31(23,24)18-19-7-5-4-6-8-19/h4-8H,9-18H2,1-3H3 |
| InChIKey | CFJOCMGZIBSSGL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|