C19H22O6S — CID 141499100
tert-butyl 2-(6-benzylsulfonyloxyhexa-2,4-diynoxy)acetate (PubChem CID 141499100) has the molecular formula C19H22O6S and a molecular weight of 378.45 g/mol. Its IUPAC name is tert-butyl 2-(6-benzylsulfonyloxyhexa-2,4-diynoxy)acetate.
| Compound Name | tert-butyl 2-(6-benzylsulfonyloxyhexa-2,4-diynoxy)acetate |
|---|---|
| PubChem CID | 141499100 |
| Molecular Formula | C19H22O6S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | tert-butyl 2-(6-benzylsulfonyloxyhexa-2,4-diynoxy)acetate |
| SMILES | CC(C)(C)OC(=O)COCC#CC#CCOS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C19H22O6S/c1-19(2,3)25-18(20)15-23-13-9-4-5-10-14-24-26(21,22)16-17-11-7-6-8-12-17/h6-8,11-12H,13-16H2,1-3H3 |
| InChIKey | QORPDCREHPKTGS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|