C19H23IO6S — CID 139721222
tert-butyl 2-[4-[methylsulfonyloxy(phenyl)-λ3-iodanyl]phenoxy]acetate (PubChem CID 139721222) has the molecular formula C19H23IO6S and a molecular weight of 506.36 g/mol. Its IUPAC name is tert-butyl 2-[4-[methylsulfonyloxy(phenyl)-λ3-iodanyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[methylsulfonyloxy(phenyl)-λ3-iodanyl]phenoxy]acetate |
|---|---|
| PubChem CID | 139721222 |
| Molecular Formula | C19H23IO6S |
| Molecular Weight | 506.36 g/mol |
| Exact Mass | 506.03 |
| IUPAC Name | tert-butyl 2-[4-[methylsulfonyloxy(phenyl)-λ3-iodanyl]phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(I(OS(C)(=O)=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H23IO6S/c1-19(2,3)25-18(21)14-24-17-12-10-16(11-13-17)20(26-27(4,22)23)15-8-6-5-7-9-15/h5-13H,14H2,1-4H3 |
| InChIKey | NCDHAJPJLSBTQZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|