C27H29F3O6S2 — CID 57058302
tert-butyl 2-[4-[bis(2-methylphenyl)-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate (PubChem CID 57058302) has the molecular formula C27H29F3O6S2 and a molecular weight of 570.65 g/mol. Its IUPAC name is tert-butyl 2-[4-[bis(2-methylphenyl)-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[bis(2-methylphenyl)-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate |
|---|---|
| PubChem CID | 57058302 |
| Molecular Formula | C27H29F3O6S2 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | tert-butyl 2-[4-[bis(2-methylphenyl)-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate |
| SMILES | Cc1ccccc1S(OS(=O)(=O)C(F)(F)F)(c1ccc(OCC(=O)OC(C)(C)C)cc1)c1ccccc1C |
| InChI | InChI=1S/C27H29F3O6S2/c1-19-10-6-8-12-23(19)37(24-13-9-7-11-20(24)2,36-38(32,33)27(28,29)30)22-16-14-21(15-17-22)34-18-25(31)35-26(3,4)5/h6-17H,18H2,1-5H3 |
| InChIKey | YAUSNPOVONVWIO-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|