C36H35F5O9S2 — CID 87491648
tert-butyl 2-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-4-[(2,3,4,5,6-pentafluorophenyl)sulfonyloxy-diphenyl-λ4-sulfanyl]phenoxy]acetate (PubChem CID 87491648) has the molecular formula C36H35F5O9S2 and a molecular weight of 770.79 g/mol. Its IUPAC name is tert-butyl 2-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-4-[(2,3,4,5,6-pentafluorophenyl)sulfonyloxy-diphenyl-λ4-sulfanyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-4-[(2,3,4,5,6-pentafluorophenyl)sulfonyloxy-diphenyl-λ4-sulfanyl]phenoxy]acetate |
|---|---|
| PubChem CID | 87491648 |
| Molecular Formula | C36H35F5O9S2 |
| Molecular Weight | 770.79 g/mol |
| Exact Mass | 770.16 |
| IUPAC Name | tert-butyl 2-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]-4-[(2,3,4,5,6-pentafluorophenyl)sulfonyloxy-diphenyl-λ4-sulfanyl]phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(S(OS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)(c2ccccc2)c2ccccc2)c(OCC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C36H35F5O9S2/c1-35(2,3)48-27(42)20-46-22-17-18-26(25(19-22)47-21-28(43)49-36(4,5)6)51(23-13-9-7-10-14-23,24-15-11-8-12-16-24)50-52(44,45)34-32(40)30(38)29(37)31(39)33(34)41/h7-19H,20-21H2,1-6H3 |
| InChIKey | NZVWCTAEZDHEEQ-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.79 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|