C25H17F5O3S3 — CID 140512560
[(4-methylsulfanylphenyl)-diphenyl-λ4-sulfanyl] 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 140512560) has the molecular formula C25H17F5O3S3 and a molecular weight of 556.60 g/mol. Its IUPAC name is [(4-methylsulfanylphenyl)-diphenyl-λ4-sulfanyl] 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | [(4-methylsulfanylphenyl)-diphenyl-λ4-sulfanyl] 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 140512560 |
| Molecular Formula | C25H17F5O3S3 |
| Molecular Weight | 556.60 g/mol |
| Exact Mass | 556.03 |
| IUPAC Name | [(4-methylsulfanylphenyl)-diphenyl-λ4-sulfanyl] 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | CSc1ccc(S(OS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H17F5O3S3/c1-34-16-12-14-19(15-13-16)35(17-8-4-2-5-9-17,18-10-6-3-7-11-18)33-36(31,32)25-23(29)21(27)20(26)22(28)24(25)30/h2-15H,1H3 |
| InChIKey | DSVIQMZMLQQMQE-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.60 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|