About [tris(4-methylphenyl)-λ4-sulfanyl] 2-fluorobenzenesulfonate
[tris(4-methylphenyl)-λ4-sulfanyl] 2-fluorobenzenesulfonate (PubChem CID 87460415) has the molecular formula C27H25FO3S2
and a molecular weight of 480.63 g/mol. Its IUPAC name is [tris(4-methylphenyl)-λ4-sulfanyl] 2-fluorobenzenesulfonate.
Molecular Properties
| Compound Name | [tris(4-methylphenyl)-λ4-sulfanyl] 2-fluorobenzenesulfonate |
| PubChem CID | 87460415 |
| Molecular Formula | C27H25FO3S2 |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | [tris(4-methylphenyl)-λ4-sulfanyl] 2-fluorobenzenesulfonate |
| SMILES | Cc1ccc(S(OS(=O)(=O)c2ccccc2F)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H25FO3S2/c1-20-8-14-23(15-9-20)32(24-16-10-21(2)11-17-24,25-18-12-22(3)13-19-25)31-33(29,30)27-7-5-4-6-26(27)28/h4-19H,1-3H3 |
| InChIKey | NKAPIJNYCLMJQN-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [tris(4-methylphenyl)-λ4-sulfanyl] 2-fluorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [tris(4-methylphenyl)-λ4-sulfanyl] 2-fluorobenzenesulfonate?
The IUPAC name of [tris(4-methylphenyl)-λ4-sulfanyl] 2-fluorobenzenesulfonate (CID 87460415) is [tris(4-methylphenyl)-λ4-sulfanyl] 2-fluorobenzenesulfonate.
What is the SMILES notation for [tris(4-methylphenyl)-λ4-sulfanyl] 2-fluorobenzenesulfonate?
The canonical SMILES for [tris(4-methylphenyl)-λ4-sulfanyl] 2-fluorobenzenesulfonate is Cc1ccc(S(OS(=O)(=O)c2ccccc2F)(c2ccc(C)cc2)c2ccc(C)cc2)cc1.
What is the InChIKey of [tris(4-methylphenyl)-λ4-sulfanyl] 2-fluorobenzenesulfonate?
The InChIKey is NKAPIJNYCLMJQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25FO3S2/c1-20-8-14-23(15-9-20)32(24-16-10-21(2)11-17-24,25-18-12-22(3)13-19-25)31-33(29,30)27-7-5-4-6-26(27)28/h4-19H,1-3H3.
What are the key properties of [tris(4-methylphenyl)-λ4-sulfanyl] 2-fluorobenzenesulfonate?
[tris(4-methylphenyl)-λ4-sulfanyl] 2-fluorobenzenesulfonate has a molecular weight of 480.63 g/mol, XLogP of 7.35, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [tris(4-methylphenyl)-λ4-sulfanyl] 2-fluorobenzenesulfonate is sourced from PubChem (CID 87460415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).