About [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate
[(4-methylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate (PubChem CID 87459274) has the molecular formula C25H20F2O3S2
and a molecular weight of 470.56 g/mol. Its IUPAC name is [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate.
Molecular Properties
| Compound Name | [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate |
| PubChem CID | 87459274 |
| Molecular Formula | C25H20F2O3S2 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate |
| SMILES | Cc1ccc(S(OS(=O)(=O)c2ccc(F)cc2F)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H20F2O3S2/c1-19-12-15-23(16-13-19)31(21-8-4-2-5-9-21,22-10-6-3-7-11-22)30-32(28,29)25-17-14-20(26)18-24(25)27/h2-18H,1H3 |
| InChIKey | HZEIXOHKHMHMNE-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate?
The IUPAC name of [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate (CID 87459274) is [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate.
What is the SMILES notation for [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate?
The canonical SMILES for [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate is Cc1ccc(S(OS(=O)(=O)c2ccc(F)cc2F)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate?
The InChIKey is HZEIXOHKHMHMNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20F2O3S2/c1-19-12-15-23(16-13-19)31(21-8-4-2-5-9-21,22-10-6-3-7-11-22)30-32(28,29)25-17-14-20(26)18-24(25)27/h2-18H,1H3.
What are the key properties of [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate?
[(4-methylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate has a molecular weight of 470.56 g/mol, XLogP of 6.88, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate is sourced from PubChem (CID 87459274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).