C25H20F2O3S2 — CID 87459274
[(4-methylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate (PubChem CID 87459274) has the molecular formula C25H20F2O3S2 and a molecular weight of 470.56 g/mol. Its IUPAC name is [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate.
| Compound Name | [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate |
|---|---|
| PubChem CID | 87459274 |
| Molecular Formula | C25H20F2O3S2 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | [(4-methylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate |
| SMILES | Cc1ccc(S(OS(=O)(=O)c2ccc(F)cc2F)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H20F2O3S2/c1-19-12-15-23(16-13-19)31(21-8-4-2-5-9-21,22-10-6-3-7-11-22)30-32(28,29)25-17-14-20(26)18-24(25)27/h2-18H,1H3 |
| InChIKey | HZEIXOHKHMHMNE-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |