C26H22F2O3S2 — CID 87491677
[(4-ethylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate (PubChem CID 87491677) has the molecular formula C26H22F2O3S2 and a molecular weight of 484.59 g/mol. Its IUPAC name is [(4-ethylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate.
| Compound Name | [(4-ethylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate |
|---|---|
| PubChem CID | 87491677 |
| Molecular Formula | C26H22F2O3S2 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | [(4-ethylphenyl)-diphenyl-λ4-sulfanyl] 2,4-difluorobenzenesulfonate |
| SMILES | CCc1ccc(S(OS(=O)(=O)c2ccc(F)cc2F)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H22F2O3S2/c1-2-20-13-16-24(17-14-20)32(22-9-5-3-6-10-22,23-11-7-4-8-12-23)31-33(29,30)26-18-15-21(27)19-25(26)28/h3-19H,2H2,1H3 |
| InChIKey | VUHWSBCIBAQARX-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |