About (triphenyl-λ4-sulfanyl) 4-butylbenzenesulfonate
(triphenyl-λ4-sulfanyl) 4-butylbenzenesulfonate (PubChem CID 87459919) has the molecular formula C28H28O3S2
and a molecular weight of 476.66 g/mol. Its IUPAC name is (triphenyl-λ4-sulfanyl) 4-butylbenzenesulfonate.
Molecular Properties
| Compound Name | (triphenyl-λ4-sulfanyl) 4-butylbenzenesulfonate |
| PubChem CID | 87459919 |
| Molecular Formula | C28H28O3S2 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | (triphenyl-λ4-sulfanyl) 4-butylbenzenesulfonate |
| SMILES | CCCCc1ccc(S(=O)(=O)OS(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H28O3S2/c1-2-3-13-24-20-22-28(23-21-24)33(29,30)31-32(25-14-7-4-8-15-25,26-16-9-5-10-17-26)27-18-11-6-12-19-27/h4-12,14-23H,2-3,13H2,1H3 |
| InChIKey | AUICBAXACSVOHH-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (triphenyl-λ4-sulfanyl) 4-butylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (triphenyl-λ4-sulfanyl) 4-butylbenzenesulfonate?
The IUPAC name of (triphenyl-λ4-sulfanyl) 4-butylbenzenesulfonate (CID 87459919) is (triphenyl-λ4-sulfanyl) 4-butylbenzenesulfonate.
What is the SMILES notation for (triphenyl-λ4-sulfanyl) 4-butylbenzenesulfonate?
The canonical SMILES for (triphenyl-λ4-sulfanyl) 4-butylbenzenesulfonate is CCCCc1ccc(S(=O)(=O)OS(c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of (triphenyl-λ4-sulfanyl) 4-butylbenzenesulfonate?
The InChIKey is AUICBAXACSVOHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28O3S2/c1-2-3-13-24-20-22-28(23-21-24)33(29,30)31-32(25-14-7-4-8-15-25,26-16-9-5-10-17-26)27-18-11-6-12-19-27/h4-12,14-23H,2-3,13H2,1H3.
What are the key properties of (triphenyl-λ4-sulfanyl) 4-butylbenzenesulfonate?
(triphenyl-λ4-sulfanyl) 4-butylbenzenesulfonate has a molecular weight of 476.66 g/mol, XLogP of 7.63, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (triphenyl-λ4-sulfanyl) 4-butylbenzenesulfonate is sourced from PubChem (CID 87459919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).