About propylsulfonyl benzenesulfonate
propylsulfonyl benzenesulfonate (PubChem CID 174788373) has the molecular formula C9H12O5S2
and a molecular weight of 264.32 g/mol. Its IUPAC name is propylsulfonyl benzenesulfonate.
Molecular Properties
| Compound Name | propylsulfonyl benzenesulfonate |
| PubChem CID | 174788373 |
| Molecular Formula | C9H12O5S2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | propylsulfonyl benzenesulfonate |
| SMILES | CCCS(=O)(=O)OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C9H12O5S2/c1-2-8-15(10,11)14-16(12,13)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 |
| InChIKey | OAQXYTBZBLNTJL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propylsulfonyl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propylsulfonyl benzenesulfonate?
The IUPAC name of propylsulfonyl benzenesulfonate (CID 174788373) is propylsulfonyl benzenesulfonate.
What is the SMILES notation for propylsulfonyl benzenesulfonate?
The canonical SMILES for propylsulfonyl benzenesulfonate is CCCS(=O)(=O)OS(=O)(=O)c1ccccc1.
What is the InChIKey of propylsulfonyl benzenesulfonate?
The InChIKey is OAQXYTBZBLNTJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O5S2/c1-2-8-15(10,11)14-16(12,13)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3.
What are the key properties of propylsulfonyl benzenesulfonate?
propylsulfonyl benzenesulfonate has a molecular weight of 264.32 g/mol, XLogP of 1.13, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propylsulfonyl benzenesulfonate is sourced from PubChem (CID 174788373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).