C14H19N2O5S2+ — CID 175037464
4-(3-methylimidazol-3-ium-1-yl)butylsulfonyl benzenesulfonate (PubChem CID 175037464) has the molecular formula C14H19N2O5S2+ and a molecular weight of 359.45 g/mol. Its IUPAC name is 4-(3-methylimidazol-3-ium-1-yl)butylsulfonyl benzenesulfonate.
| Compound Name | 4-(3-methylimidazol-3-ium-1-yl)butylsulfonyl benzenesulfonate |
|---|---|
| PubChem CID | 175037464 |
| Molecular Formula | C14H19N2O5S2+ |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 4-(3-methylimidazol-3-ium-1-yl)butylsulfonyl benzenesulfonate |
| SMILES | C[n+]1ccn(CCCCS(=O)(=O)OS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C14H19N2O5S2/c1-15-10-11-16(13-15)9-5-6-12-22(17,18)21-23(19,20)14-7-3-2-4-8-14/h2-4,7-8,10-11,13H,5-6,9,12H2,1H3/q+1 |
| InChIKey | PSPSPPKWHILVMP-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 86.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|