C9H17N2O2S+ — CID 158970323
1-methyl-3-(4-methylsulfonylbutyl)imidazol-1-ium (PubChem CID 158970323) has the molecular formula C9H17N2O2S+ and a molecular weight of 217.31 g/mol. Its IUPAC name is 1-methyl-3-(4-methylsulfonylbutyl)imidazol-1-ium.
| Compound Name | 1-methyl-3-(4-methylsulfonylbutyl)imidazol-1-ium |
|---|---|
| PubChem CID | 158970323 |
| Molecular Formula | C9H17N2O2S+ |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 1-methyl-3-(4-methylsulfonylbutyl)imidazol-1-ium |
| SMILES | C[n+]1ccn(CCCCS(C)(=O)=O)c1 |
| InChI | InChI=1S/C9H17N2O2S/c1-10-6-7-11(9-10)5-3-4-8-14(2,12)13/h6-7,9H,3-5,8H2,1-2H3/q+1 |
| InChIKey | NODXQRBALTVADR-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 42.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|