C23H39N6+3 — CID 102441081
1,3-bis[6-(3-methylimidazol-3-ium-1-yl)hexyl]imidazol-1-ium (PubChem CID 102441081) has the molecular formula C23H39N6+3 and a molecular weight of 399.61 g/mol. Its IUPAC name is 1,3-bis[6-(3-methylimidazol-3-ium-1-yl)hexyl]imidazol-1-ium.
| Compound Name | 1,3-bis[6-(3-methylimidazol-3-ium-1-yl)hexyl]imidazol-1-ium |
|---|---|
| PubChem CID | 102441081 |
| Molecular Formula | C23H39N6+3 |
| Molecular Weight | 399.61 g/mol |
| Exact Mass | 399.32 |
| IUPAC Name | 1,3-bis[6-(3-methylimidazol-3-ium-1-yl)hexyl]imidazol-1-ium |
| SMILES | C[n+]1ccn(CCCCCCn2cc[n+](CCCCCCn3cc[n+](C)c3)c2)c1 |
| InChI | InChI=1S/C23H39N6/c1-24-15-17-26(21-24)11-7-3-5-9-13-28-19-20-29(23-28)14-10-6-4-8-12-27-18-16-25(2)22-27/h15-23H,3-14H2,1-2H3/q+3 |
| InChIKey | MELUEQQZHKLKOF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.61 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|