C17H27N6+3 — CID 132509484
1,3-bis[3-(3-methylimidazol-3-ium-1-yl)propyl]imidazol-1-ium (PubChem CID 132509484) has the molecular formula C17H27N6+3 and a molecular weight of 315.45 g/mol. Its IUPAC name is 1,3-bis[3-(3-methylimidazol-3-ium-1-yl)propyl]imidazol-1-ium.
| Compound Name | 1,3-bis[3-(3-methylimidazol-3-ium-1-yl)propyl]imidazol-1-ium |
|---|---|
| PubChem CID | 132509484 |
| Molecular Formula | C17H27N6+3 |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 1,3-bis[3-(3-methylimidazol-3-ium-1-yl)propyl]imidazol-1-ium |
| SMILES | C[n+]1ccn(CCCn2cc[n+](CCCn3cc[n+](C)c3)c2)c1 |
| InChI | InChI=1S/C17H27N6/c1-18-9-11-20(15-18)5-3-7-22-13-14-23(17-22)8-4-6-21-12-10-19(2)16-21/h9-17H,3-8H2,1-2H3/q+3 |
| InChIKey | BDTLJYGQENUOAX-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 26.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|