C12H25N2O7PS — CID 87059909
diethyl phosphate;4-(3-methylimidazol-3-ium-1-yl)butane-1-sulfonic acid (PubChem CID 87059909) has the molecular formula C12H25N2O7PS and a molecular weight of 372.38 g/mol. Its IUPAC name is diethyl phosphate;4-(3-methylimidazol-3-ium-1-yl)butane-1-sulfonic acid.
| Compound Name | diethyl phosphate;4-(3-methylimidazol-3-ium-1-yl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 87059909 |
| Molecular Formula | C12H25N2O7PS |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | diethyl phosphate;4-(3-methylimidazol-3-ium-1-yl)butane-1-sulfonic acid |
| SMILES | CCOP(=O)([O-])OCC.C[n+]1ccn(CCCCS(=O)(=O)O)c1 |
| InChI | InChI=1S/C8H14N2O3S.C4H11O4P/c1-9-5-6-10(8-9)4-2-3-7-14(11,12)13;1-3-7-9(5,6)8-4-2/h5-6,8H,2-4,7H2,1H3;3-4H2,1-2H3,(H,5,6) |
| InChIKey | YTCDLMUZLLWVGG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|