About dimethyl phosphate;1-hexadecyl-3-methylimidazol-3-ium
dimethyl phosphate;1-hexadecyl-3-methylimidazol-3-ium (PubChem CID 86677011) has the molecular formula C22H45N2O4P
and a molecular weight of 432.59 g/mol. Its IUPAC name is dimethyl phosphate;1-hexadecyl-3-methylimidazol-3-ium.
Molecular Properties
| Compound Name | dimethyl phosphate;1-hexadecyl-3-methylimidazol-3-ium |
| PubChem CID | 86677011 |
| Molecular Formula | C22H45N2O4P |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | dimethyl phosphate;1-hexadecyl-3-methylimidazol-3-ium |
| SMILES | CCCCCCCCCCCCCCCCn1cc[n+](C)c1.COP(=O)([O-])OC |
| InChI | InChI=1S/C20H39N2.C2H7O4P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-19-18-21(2)20-22;1-5-7(3,4)6-2/h18-20H,3-17H2,1-2H3;1-2H3,(H,3,4)/q+1;/p-1 |
| InChIKey | CMKNYRWLZMFHGM-UHFFFAOYSA-M |
| XLogP | 5.54 |
| TPSA | 67.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl phosphate;1-hexadecyl-3-methylimidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl phosphate;1-hexadecyl-3-methylimidazol-3-ium?
The IUPAC name of dimethyl phosphate;1-hexadecyl-3-methylimidazol-3-ium (CID 86677011) is dimethyl phosphate;1-hexadecyl-3-methylimidazol-3-ium.
What is the SMILES notation for dimethyl phosphate;1-hexadecyl-3-methylimidazol-3-ium?
The canonical SMILES for dimethyl phosphate;1-hexadecyl-3-methylimidazol-3-ium is CCCCCCCCCCCCCCCCn1cc[n+](C)c1.COP(=O)([O-])OC.
What is the InChIKey of dimethyl phosphate;1-hexadecyl-3-methylimidazol-3-ium?
The InChIKey is CMKNYRWLZMFHGM-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H39N2.C2H7O4P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-19-18-21(2)20-22;1-5-7(3,4)6-2/h18-20H,3-17H2,1-2H3;1-2H3,(H,3,4)/q+1;/p-1.
What are the key properties of dimethyl phosphate;1-hexadecyl-3-methylimidazol-3-ium?
dimethyl phosphate;1-hexadecyl-3-methylimidazol-3-ium has a molecular weight of 432.59 g/mol, XLogP of 5.54, 17 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl phosphate;1-hexadecyl-3-methylimidazol-3-ium is sourced from PubChem (CID 86677011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).