C18H37N2O4P — CID 89414402
dipropyl phosphate;1-methyl-3-octylimidazol-1-ium (PubChem CID 89414402) has the molecular formula C18H37N2O4P and a molecular weight of 376.48 g/mol. Its IUPAC name is dipropyl phosphate;1-methyl-3-octylimidazol-1-ium.
| Compound Name | dipropyl phosphate;1-methyl-3-octylimidazol-1-ium |
|---|---|
| PubChem CID | 89414402 |
| Molecular Formula | C18H37N2O4P |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | dipropyl phosphate;1-methyl-3-octylimidazol-1-ium |
| SMILES | CCCCCCCCn1cc[n+](C)c1.CCCOP(=O)([O-])OCCC |
| InChI | InChI=1S/C12H23N2.C6H15O4P/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;1-3-5-9-11(7,8)10-6-4-2/h10-12H,3-9H2,1-2H3;3-6H2,1-2H3,(H,7,8)/q+1;/p-1 |
| InChIKey | BCJSFRQFPBQZLG-UHFFFAOYSA-M |
| XLogP | 3.98 |
| TPSA | 67.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|