About 1-butyl-3-methylimidazol-3-ium;trimethyl phosphate
1-butyl-3-methylimidazol-3-ium;trimethyl phosphate (PubChem CID 175119009) has the molecular formula C11H24N2O4P+
and a molecular weight of 279.30 g/mol. Its IUPAC name is 1-butyl-3-methylimidazol-3-ium;trimethyl phosphate.
Molecular Properties
| Compound Name | 1-butyl-3-methylimidazol-3-ium;trimethyl phosphate |
| PubChem CID | 175119009 |
| Molecular Formula | C11H24N2O4P+ |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 1-butyl-3-methylimidazol-3-ium;trimethyl phosphate |
| SMILES | CCCCn1cc[n+](C)c1.COP(=O)(OC)OC |
| InChI | InChI=1S/C8H15N2.C3H9O4P/c1-3-4-5-10-7-6-9(2)8-10;1-5-8(4,6-2)7-3/h6-8H,3-5H2,1-2H3;1-3H3/q+1; |
| InChIKey | VSJNKCUBXZYHFQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 53.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methylimidazol-3-ium;trimethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methylimidazol-3-ium;trimethyl phosphate?
The IUPAC name of 1-butyl-3-methylimidazol-3-ium;trimethyl phosphate (CID 175119009) is 1-butyl-3-methylimidazol-3-ium;trimethyl phosphate.
What is the SMILES notation for 1-butyl-3-methylimidazol-3-ium;trimethyl phosphate?
The canonical SMILES for 1-butyl-3-methylimidazol-3-ium;trimethyl phosphate is CCCCn1cc[n+](C)c1.COP(=O)(OC)OC.
What is the InChIKey of 1-butyl-3-methylimidazol-3-ium;trimethyl phosphate?
The InChIKey is VSJNKCUBXZYHFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N2.C3H9O4P/c1-3-4-5-10-7-6-9(2)8-10;1-5-8(4,6-2)7-3/h6-8H,3-5H2,1-2H3;1-3H3/q+1;.
What are the key properties of 1-butyl-3-methylimidazol-3-ium;trimethyl phosphate?
1-butyl-3-methylimidazol-3-ium;trimethyl phosphate has a molecular weight of 279.30 g/mol, XLogP of 2.15, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methylimidazol-3-ium;trimethyl phosphate is sourced from PubChem (CID 175119009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).