1-butyl-3-methylimidazol-3-ium;fluoro hydrogen phosphate

C8H16FN2O4P — CID 173257218

IUPAC1-butyl-3-methylimidazol-3-ium;fluoro hydrogen phosphate
SMILESCCCCn1cc[n+](C)c1.O=P([O-])(O)OF
InChIInChI=1S/C8H15N2.FH2O4P/c1-3-4-5-10-7-6-9(2)8-10;1-5-6(2,3)4/h6-8H,3-5H2,1-2H3;(H2,2,3,4)/q+1;/p-1
InChIKeyHQJYIJKSSPCEIM-UHFFFAOYSA-M
MW254.20 g/mol
LogP0.46
Rot. Bonds4

About 1-butyl-3-methylimidazol-3-ium;fluoro hydrogen phosphate

1-butyl-3-methylimidazol-3-ium;fluoro hydrogen phosphate (PubChem CID 173257218) has the molecular formula C8H16FN2O4P and a molecular weight of 254.20 g/mol. Its IUPAC name is 1-butyl-3-methylimidazol-3-ium;fluoro hydrogen phosphate.

Molecular Properties

Compound Name1-butyl-3-methylimidazol-3-ium;fluoro hydrogen phosphate
PubChem CID173257218
Molecular FormulaC8H16FN2O4P
Molecular Weight254.20 g/mol
Exact Mass254.08
IUPAC Name1-butyl-3-methylimidazol-3-ium;fluoro hydrogen phosphate
SMILESCCCCn1cc[n+](C)c1.O=P([O-])(O)OF
InChIInChI=1S/C8H15N2.FH2O4P/c1-3-4-5-10-7-6-9(2)8-10;1-5-6(2,3)4/h6-8H,3-5H2,1-2H3;(H2,2,3,4)/q+1;/p-1
InChIKeyHQJYIJKSSPCEIM-UHFFFAOYSA-M
XLogP0.46
TPSA78.40 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.20
LogP ≤ 50.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 1-butyl-3-methylimidazol-3-ium;fluoro hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-butyl-3-methylimidazol-3-ium;fluoro hydrogen phosphate?
The IUPAC name of 1-butyl-3-methylimidazol-3-ium;fluoro hydrogen phosphate (CID 173257218) is 1-butyl-3-methylimidazol-3-ium;fluoro hydrogen phosphate.
What is the SMILES notation for 1-butyl-3-methylimidazol-3-ium;fluoro hydrogen phosphate?
The canonical SMILES for 1-butyl-3-methylimidazol-3-ium;fluoro hydrogen phosphate is CCCCn1cc[n+](C)c1.O=P([O-])(O)OF.
What is the InChIKey of 1-butyl-3-methylimidazol-3-ium;fluoro hydrogen phosphate?
The InChIKey is HQJYIJKSSPCEIM-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H15N2.FH2O4P/c1-3-4-5-10-7-6-9(2)8-10;1-5-6(2,3)4/h6-8H,3-5H2,1-2H3;(H2,2,3,4)/q+1;/p-1.
What are the key properties of 1-butyl-3-methylimidazol-3-ium;fluoro hydrogen phosphate?
1-butyl-3-methylimidazol-3-ium;fluoro hydrogen phosphate has a molecular weight of 254.20 g/mol, XLogP of 0.46, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methylimidazol-3-ium;fluoro hydrogen phosphate is sourced from PubChem (CID 173257218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).