C8H16FN2O4P — CID 173257218
1-butyl-3-methylimidazol-3-ium;fluoro hydrogen phosphate (PubChem CID 173257218) has the molecular formula C8H16FN2O4P and a molecular weight of 254.20 g/mol. Its IUPAC name is 1-butyl-3-methylimidazol-3-ium;fluoro hydrogen phosphate.
| Compound Name | 1-butyl-3-methylimidazol-3-ium;fluoro hydrogen phosphate |
|---|---|
| PubChem CID | 173257218 |
| Molecular Formula | C8H16FN2O4P |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 1-butyl-3-methylimidazol-3-ium;fluoro hydrogen phosphate |
| SMILES | CCCCn1cc[n+](C)c1.O=P([O-])(O)OF |
| InChI | InChI=1S/C8H15N2.FH2O4P/c1-3-4-5-10-7-6-9(2)8-10;1-5-6(2,3)4/h6-8H,3-5H2,1-2H3;(H2,2,3,4)/q+1;/p-1 |
| InChIKey | HQJYIJKSSPCEIM-UHFFFAOYSA-M |
| XLogP | 0.46 |
| TPSA | 78.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|