C12H15F10N2O2P — CID 18451606
bis(1,1,2,2,2-pentafluoroethyl)phosphinate;1-butyl-3-methylimidazol-3-ium (PubChem CID 18451606) has the molecular formula C12H15F10N2O2P and a molecular weight of 440.22 g/mol. Its IUPAC name is bis(1,1,2,2,2-pentafluoroethyl)phosphinate;1-butyl-3-methylimidazol-3-ium.
| Compound Name | bis(1,1,2,2,2-pentafluoroethyl)phosphinate;1-butyl-3-methylimidazol-3-ium |
|---|---|
| PubChem CID | 18451606 |
| Molecular Formula | C12H15F10N2O2P |
| Molecular Weight | 440.22 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | bis(1,1,2,2,2-pentafluoroethyl)phosphinate;1-butyl-3-methylimidazol-3-ium |
| SMILES | CCCCn1cc[n+](C)c1.O=P([O-])(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H15N2.C4HF10O2P/c1-3-4-5-10-7-6-9(2)8-10;5-1(6,7)3(11,12)17(15,16)4(13,14)2(8,9)10/h6-8H,3-5H2,1-2H3;(H,15,16)/q+1;/p-1 |
| InChIKey | CCMGWQKKOYVFNL-UHFFFAOYSA-M |
| XLogP | 4.05 |
| TPSA | 48.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.22 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|