C10H17F3N2O3S — CID 140652261
1-butyl-3-methylimidazol-3-ium;2,2,2-trifluoroethanesulfonate (PubChem CID 140652261) has the molecular formula C10H17F3N2O3S and a molecular weight of 302.32 g/mol. Its IUPAC name is 1-butyl-3-methylimidazol-3-ium;2,2,2-trifluoroethanesulfonate.
| Compound Name | 1-butyl-3-methylimidazol-3-ium;2,2,2-trifluoroethanesulfonate |
|---|---|
| PubChem CID | 140652261 |
| Molecular Formula | C10H17F3N2O3S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 1-butyl-3-methylimidazol-3-ium;2,2,2-trifluoroethanesulfonate |
| SMILES | CCCCn1cc[n+](C)c1.O=S(=O)([O-])CC(F)(F)F |
| InChI | InChI=1S/C8H15N2.C2H3F3O3S/c1-3-4-5-10-7-6-9(2)8-10;3-2(4,5)1-9(6,7)8/h6-8H,3-5H2,1-2H3;1H2,(H,6,7,8)/q+1;/p-1 |
| InChIKey | WGCOTPLCCFYGKV-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|