C12H19F6N3O4S2 — CID 22061689
bis(2,2,2-trifluoroethylsulfonyl)azanide;1-butyl-3-methylimidazol-3-ium (PubChem CID 22061689) has the molecular formula C12H19F6N3O4S2 and a molecular weight of 447.42 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethylsulfonyl)azanide;1-butyl-3-methylimidazol-3-ium.
| Compound Name | bis(2,2,2-trifluoroethylsulfonyl)azanide;1-butyl-3-methylimidazol-3-ium |
|---|---|
| PubChem CID | 22061689 |
| Molecular Formula | C12H19F6N3O4S2 |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | bis(2,2,2-trifluoroethylsulfonyl)azanide;1-butyl-3-methylimidazol-3-ium |
| SMILES | CCCCn1cc[n+](C)c1.O=S(=O)(CC(F)(F)F)[N-]S(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C8H15N2.C4H4F6NO4S2/c1-3-4-5-10-7-6-9(2)8-10;5-3(6,7)1-16(12,13)11-17(14,15)2-4(8,9)10/h6-8H,3-5H2,1-2H3;1-2H2/q+1;-1 |
| InChIKey | KPJGKILBCMRTSX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 91.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|