C11H13F10N3O4S2 — CID 140963555
bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;1-methyl-3-propylimidazol-1-ium (PubChem CID 140963555) has the molecular formula C11H13F10N3O4S2 and a molecular weight of 505.36 g/mol. Its IUPAC name is bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;1-methyl-3-propylimidazol-1-ium.
| Compound Name | bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;1-methyl-3-propylimidazol-1-ium |
|---|---|
| PubChem CID | 140963555 |
| Molecular Formula | C11H13F10N3O4S2 |
| Molecular Weight | 505.36 g/mol |
| Exact Mass | 505.02 |
| IUPAC Name | bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;1-methyl-3-propylimidazol-1-ium |
| SMILES | CCCn1cc[n+](C)c1.O=S(=O)([N-]S(=O)(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H13N2.C4F10NO4S2/c1-3-4-9-6-5-8(2)7-9;5-1(6,7)3(11,12)20(16,17)15-21(18,19)4(13,14)2(8,9)10/h5-7H,3-4H2,1-2H3;/q+1;-1 |
| InChIKey | PTVBRLIYPZAJCD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 91.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|