C14H23F6N3O5S2 — CID 153320976
bis(trifluoromethylsulfonyl)azanide;8-(3-methylimidazol-3-ium-1-yl)octan-1-ol (PubChem CID 153320976) has the molecular formula C14H23F6N3O5S2 and a molecular weight of 491.48 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;8-(3-methylimidazol-3-ium-1-yl)octan-1-ol.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;8-(3-methylimidazol-3-ium-1-yl)octan-1-ol |
|---|---|
| PubChem CID | 153320976 |
| Molecular Formula | C14H23F6N3O5S2 |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;8-(3-methylimidazol-3-ium-1-yl)octan-1-ol |
| SMILES | C[n+]1ccn(CCCCCCCCO)c1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H23N2O.C2F6NO4S2/c1-13-9-10-14(12-13)8-6-4-2-3-5-7-11-15;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h9-10,12,15H,2-8,11H2,1H3;/q+1;-1 |
| InChIKey | HOCJYTAADMASGT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 111.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|