C8H11F6N3O5S2 — CID 23628825
bis(trifluoromethylsulfonyl)azanide;1-(methoxymethyl)-3-methylimidazol-3-ium (PubChem CID 23628825) has the molecular formula C8H11F6N3O5S2 and a molecular weight of 407.31 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1-(methoxymethyl)-3-methylimidazol-3-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1-(methoxymethyl)-3-methylimidazol-3-ium |
|---|---|
| PubChem CID | 23628825 |
| Molecular Formula | C8H11F6N3O5S2 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 407.00 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1-(methoxymethyl)-3-methylimidazol-3-ium |
| SMILES | COCn1cc[n+](C)c1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H11N2O.C2F6NO4S2/c1-7-3-4-8(5-7)6-9-2;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-5H,6H2,1-2H3;/q+1;-1 |
| InChIKey | IJQYQTQHPYXKOE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 100.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|