C25H45F6N3O6S2 — CID 11456564
1,3-bis(nonoxymethyl)imidazol-1-ium;bis(trifluoromethylsulfonyl)azanide (PubChem CID 11456564) has the molecular formula C25H45F6N3O6S2 and a molecular weight of 661.77 g/mol. Its IUPAC name is 1,3-bis(nonoxymethyl)imidazol-1-ium;bis(trifluoromethylsulfonyl)azanide.
| Compound Name | 1,3-bis(nonoxymethyl)imidazol-1-ium;bis(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 11456564 |
| Molecular Formula | C25H45F6N3O6S2 |
| Molecular Weight | 661.77 g/mol |
| Exact Mass | 661.27 |
| IUPAC Name | 1,3-bis(nonoxymethyl)imidazol-1-ium;bis(trifluoromethylsulfonyl)azanide |
| SMILES | CCCCCCCCCOCn1cc[n+](COCCCCCCCCC)c1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H45N2O2.C2F6NO4S2/c1-3-5-7-9-11-13-15-19-26-22-24-17-18-25(21-24)23-27-20-16-14-12-10-8-6-4-2;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h17-18,21H,3-16,19-20,22-23H2,1-2H3;/q+1;-1 |
| InChIKey | WDOYUMWTKZIRCS-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 109.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.77 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|