C13H25F6N2O2P — CID 11463303
1,3-bis(butoxymethyl)imidazol-1-ium hexafluorophosphate (PubChem CID 11463303) has the molecular formula C13H25F6N2O2P and a molecular weight of 386.32 g/mol. Its IUPAC name is 1,3-bis(butoxymethyl)imidazol-1-ium hexafluorophosphate.
| Compound Name | 1,3-bis(butoxymethyl)imidazol-1-ium hexafluorophosphate |
|---|---|
| PubChem CID | 11463303 |
| Molecular Formula | C13H25F6N2O2P |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 1,3-bis(butoxymethyl)imidazol-1-ium hexafluorophosphate |
| SMILES | CCCCOCn1cc[n+](COCCCC)c1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C13H25N2O2.F6P/c1-3-5-9-16-12-14-7-8-15(11-14)13-17-10-6-4-2;1-7(2,3,4,5)6/h7-8,11H,3-6,9-10,12-13H2,1-2H3;/q+1;-1 |
| InChIKey | KPYYNADCDSDQCC-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|