C9H17N2O2+ — CID 87745268
1,3-bis(ethoxymethyl)imidazol-1-ium (PubChem CID 87745268) has the molecular formula C9H17N2O2+ and a molecular weight of 185.25 g/mol. Its IUPAC name is 1,3-bis(ethoxymethyl)imidazol-1-ium.
| Compound Name | 1,3-bis(ethoxymethyl)imidazol-1-ium |
|---|---|
| PubChem CID | 87745268 |
| Molecular Formula | C9H17N2O2+ |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.13 |
| IUPAC Name | 1,3-bis(ethoxymethyl)imidazol-1-ium |
| SMILES | CCOCn1cc[n+](COCC)c1 |
| InChI | InChI=1S/C9H17N2O2/c1-3-12-8-10-5-6-11(7-10)9-13-4-2/h5-7H,3-4,8-9H2,1-2H3/q+1 |
| InChIKey | LBALOTJHVLGPTJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|