C10H19N2O+ — CID 125115309
1-ethyl-3-(2-methylpropoxymethyl)imidazol-3-ium (PubChem CID 125115309) has the molecular formula C10H19N2O+ and a molecular weight of 183.27 g/mol. Its IUPAC name is 1-ethyl-3-(2-methylpropoxymethyl)imidazol-3-ium.
| Compound Name | 1-ethyl-3-(2-methylpropoxymethyl)imidazol-3-ium |
|---|---|
| PubChem CID | 125115309 |
| Molecular Formula | C10H19N2O+ |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.15 |
| IUPAC Name | 1-ethyl-3-(2-methylpropoxymethyl)imidazol-3-ium |
| SMILES | CCn1cc[n+](COCC(C)C)c1 |
| InChI | InChI=1S/C10H19N2O/c1-4-11-5-6-12(8-11)9-13-7-10(2)3/h5-6,8,10H,4,7,9H2,1-3H3/q+1 |
| InChIKey | GRNQFWJPUSIFQU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|