C18H33N2O2+ — CID 52921163
1-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]-3-(propoxymethyl)imidazol-3-ium (PubChem CID 52921163) has the molecular formula C18H33N2O2+ and a molecular weight of 309.47 g/mol. Its IUPAC name is 1-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]-3-(propoxymethyl)imidazol-3-ium.
| Compound Name | 1-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]-3-(propoxymethyl)imidazol-3-ium |
|---|---|
| PubChem CID | 52921163 |
| Molecular Formula | C18H33N2O2+ |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | 1-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]-3-(propoxymethyl)imidazol-3-ium |
| SMILES | CCCOC[n+]1ccn(CO[C@@H]2C[C@H](C)CC[C@H]2C(C)C)c1 |
| InChI | InChI=1S/C18H33N2O2/c1-5-10-21-13-19-8-9-20(12-19)14-22-18-11-16(4)6-7-17(18)15(2)3/h8-9,12,15-18H,5-7,10-11,13-14H2,1-4H3/q+1/t16-,17+,18-/m1/s1 |
| InChIKey | QEBOJPOALWFFRJ-FGTMMUONSA-N |
| XLogP | 3.59 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|