C16H29ClN2O — CID 16681463
1-ethyl-3-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]imidazol-3-ium chloride (PubChem CID 16681463) has the molecular formula C16H29ClN2O and a molecular weight of 300.87 g/mol. Its IUPAC name is 1-ethyl-3-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]imidazol-3-ium chloride.
| Compound Name | 1-ethyl-3-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]imidazol-3-ium chloride |
|---|---|
| PubChem CID | 16681463 |
| Molecular Formula | C16H29ClN2O |
| Molecular Weight | 300.87 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 1-ethyl-3-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]imidazol-3-ium chloride |
| SMILES | CCn1cc[n+](CO[C@@H]2C[C@H](C)CC[C@H]2C(C)C)c1.[Cl-] |
| InChI | InChI=1S/C16H29N2O.ClH/c1-5-17-8-9-18(11-17)12-19-16-10-14(4)6-7-15(16)13(2)3;/h8-9,11,13-16H,5-7,10,12H2,1-4H3;1H/q+1;/p-1/t14-,15+,16-;/m1./s1 |
| InChIKey | QVUMCRMBCSIICD-GBEOHXTHSA-M |
| XLogP | 0.23 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.87 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|