C15H27BF4N2O — CID 91824200
1-methyl-3-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]imidazol-1-ium tetrafluoroborate (PubChem CID 91824200) has the molecular formula C15H27BF4N2O and a molecular weight of 338.20 g/mol. Its IUPAC name is 1-methyl-3-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]imidazol-1-ium tetrafluoroborate.
| Compound Name | 1-methyl-3-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]imidazol-1-ium tetrafluoroborate |
|---|---|
| PubChem CID | 91824200 |
| Molecular Formula | C15H27BF4N2O |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 1-methyl-3-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]imidazol-1-ium tetrafluoroborate |
| SMILES | CC(C)C1CC[C@@H](C)C[C@H]1OCn1cc[n+](C)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C15H27N2O.BF4/c1-12(2)14-6-5-13(3)9-15(14)18-11-17-8-7-16(4)10-17;2-1(3,4)5/h7-8,10,12-15H,5-6,9,11H2,1-4H3;/q+1;-1/t13-,14?,15-;/m1./s1 |
| InChIKey | BJMAPMRRQSKCPW-LILTVWHLSA-N |
| XLogP | 4.05 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|