C24H45N2O2+ — CID 71696829
1-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-3-(nonoxymethyl)imidazol-3-ium (PubChem CID 71696829) has the molecular formula C24H45N2O2+ and a molecular weight of 393.64 g/mol. Its IUPAC name is 1-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-3-(nonoxymethyl)imidazol-3-ium.
| Compound Name | 1-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-3-(nonoxymethyl)imidazol-3-ium |
|---|---|
| PubChem CID | 71696829 |
| Molecular Formula | C24H45N2O2+ |
| Molecular Weight | 393.64 g/mol |
| Exact Mass | 393.35 |
| IUPAC Name | 1-[(5-methyl-2-propan-2-ylcyclohexyl)oxymethyl]-3-(nonoxymethyl)imidazol-3-ium |
| SMILES | CCCCCCCCCOC[n+]1ccn(COC2CC(C)CCC2C(C)C)c1 |
| InChI | InChI=1S/C24H45N2O2/c1-5-6-7-8-9-10-11-16-27-19-25-14-15-26(18-25)20-28-24-17-22(4)12-13-23(24)21(2)3/h14-15,18,21-24H,5-13,16-17,19-20H2,1-4H3/q+1 |
| InChIKey | XWOGCNBKGWUZRX-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.64 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|