C23H43ClN2O — CID 16681501
1-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]-3-nonylimidazol-1-ium chloride (PubChem CID 16681501) has the molecular formula C23H43ClN2O and a molecular weight of 399.06 g/mol. Its IUPAC name is 1-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]-3-nonylimidazol-1-ium chloride.
| Compound Name | 1-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]-3-nonylimidazol-1-ium chloride |
|---|---|
| PubChem CID | 16681501 |
| Molecular Formula | C23H43ClN2O |
| Molecular Weight | 399.06 g/mol |
| Exact Mass | 398.31 |
| IUPAC Name | 1-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]-3-nonylimidazol-1-ium chloride |
| SMILES | CCCCCCCCCn1cc[n+](CO[C@@H]2C[C@H](C)CC[C@H]2C(C)C)c1.[Cl-] |
| InChI | InChI=1S/C23H43N2O.ClH/c1-5-6-7-8-9-10-11-14-24-15-16-25(18-24)19-26-23-17-21(4)12-13-22(23)20(2)3;/h15-16,18,20-23H,5-14,17,19H2,1-4H3;1H/q+1;/p-1/t21-,22+,23-;/m1./s1 |
| InChIKey | JFZJIDWUSPFKSK-HZLAGBECSA-M |
| XLogP | 2.97 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.06 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|