C21H44ClNO — CID 11516047
dimethyl-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]-octylazanium chloride (PubChem CID 11516047) has the molecular formula C21H44ClNO and a molecular weight of 362.04 g/mol. Its IUPAC name is dimethyl-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]-octylazanium chloride.
| Compound Name | dimethyl-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]-octylazanium chloride |
|---|---|
| PubChem CID | 11516047 |
| Molecular Formula | C21H44ClNO |
| Molecular Weight | 362.04 g/mol |
| Exact Mass | 361.31 |
| IUPAC Name | dimethyl-[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxymethyl]-octylazanium chloride |
| SMILES | CCCCCCCC[N+](C)(C)CO[C@@H]1C[C@H](C)CC[C@H]1C(C)C.[Cl-] |
| InChI | InChI=1S/C21H44NO.ClH/c1-7-8-9-10-11-12-15-22(5,6)17-23-21-16-19(4)13-14-20(21)18(2)3;/h18-21H,7-17H2,1-6H3;1H/q+1;/p-1/t19-,20+,21-;/m1./s1 |
| InChIKey | FYPLESSDSKZMDW-SXWPHCFWSA-M |
| XLogP | 2.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.04 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|