C18H38NO2+ — CID 124768566
diethyl-[(2S)-2-hydroxy-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropyl]-methylazanium (PubChem CID 124768566) has the molecular formula C18H38NO2+ and a molecular weight of 300.51 g/mol. Its IUPAC name is diethyl-[(2S)-2-hydroxy-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropyl]-methylazanium.
| Compound Name | diethyl-[(2S)-2-hydroxy-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropyl]-methylazanium |
|---|---|
| PubChem CID | 124768566 |
| Molecular Formula | C18H38NO2+ |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.29 |
| IUPAC Name | diethyl-[(2S)-2-hydroxy-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropyl]-methylazanium |
| SMILES | CC[N+](C)(CC)C[C@H](O)CO[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C18H38NO2/c1-7-19(6,8-2)12-16(20)13-21-18-11-15(5)9-10-17(18)14(3)4/h14-18,20H,7-13H2,1-6H3/q+1/t15-,16+,17+,18-/m1/s1 |
| InChIKey | VVKLZZCUENYXJG-VSZNYVQBSA-N |
| XLogP | 3.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|