C12H24O — CID 11086237
(1S,2R,4R)-2-ethoxy-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 11086237) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is (1S,2R,4R)-2-ethoxy-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | (1S,2R,4R)-2-ethoxy-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 11086237 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | (1S,2R,4R)-2-ethoxy-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | CCO[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C12H24O/c1-5-13-12-8-10(4)6-7-11(12)9(2)3/h9-12H,5-8H2,1-4H3/t10-,11+,12-/m1/s1 |
| InChIKey | XZAREUVKALEUIS-GRYCIOLGSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |