C12H23BrO — CID 22883721
(1S,2R,4R)-2-(2-bromoethoxy)-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 22883721) has the molecular formula C12H23BrO and a molecular weight of 263.22 g/mol. Its IUPAC name is (1S,2R,4R)-2-(2-bromoethoxy)-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | (1S,2R,4R)-2-(2-bromoethoxy)-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 22883721 |
| Molecular Formula | C12H23BrO |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | (1S,2R,4R)-2-(2-bromoethoxy)-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OCCBr |
| InChI | InChI=1S/C12H23BrO/c1-9(2)11-5-4-10(3)8-12(11)14-7-6-13/h9-12H,4-8H2,1-3H3/t10-,11+,12-/m1/s1 |
| InChIKey | QUHGADATHHCBEP-GRYCIOLGSA-N |
| XLogP | 3.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|