C12H24OS — CID 131866620
2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethanethiol (PubChem CID 131866620) has the molecular formula C12H24OS and a molecular weight of 216.39 g/mol. Its IUPAC name is 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethanethiol.
| Compound Name | 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethanethiol |
|---|---|
| PubChem CID | 131866620 |
| Molecular Formula | C12H24OS |
| Molecular Weight | 216.39 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethanethiol |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OCCS |
| InChI | InChI=1S/C12H24OS/c1-9(2)11-5-4-10(3)8-12(11)13-6-7-14/h9-12,14H,4-8H2,1-3H3/t10-,11+,12-/m1/s1 |
| InChIKey | ICMJEETZSLOHEV-GRYCIOLGSA-N |
| XLogP | 3.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|