C14H26O — CID 59927770
(1S,2R,4R)-2-but-3-enoxy-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 59927770) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is (1S,2R,4R)-2-but-3-enoxy-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | (1S,2R,4R)-2-but-3-enoxy-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 59927770 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | (1S,2R,4R)-2-but-3-enoxy-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | C=CCCO[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C14H26O/c1-5-6-9-15-14-10-12(4)7-8-13(14)11(2)3/h5,11-14H,1,6-10H2,2-4H3/t12-,13+,14-/m1/s1 |
| InChIKey | SQQAEBIELSFJOS-HZSPNIEDSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|