C17H32O — CID 15373905
(1S,2R,4R)-4-methyl-2-(2-methylhex-5-en-3-yloxy)-1-propan-2-ylcyclohexane (PubChem CID 15373905) has the molecular formula C17H32O and a molecular weight of 252.44 g/mol. Its IUPAC name is (1S,2R,4R)-4-methyl-2-(2-methylhex-5-en-3-yloxy)-1-propan-2-ylcyclohexane.
| Compound Name | (1S,2R,4R)-4-methyl-2-(2-methylhex-5-en-3-yloxy)-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 15373905 |
| Molecular Formula | C17H32O |
| Molecular Weight | 252.44 g/mol |
| Exact Mass | 252.25 |
| IUPAC Name | (1S,2R,4R)-4-methyl-2-(2-methylhex-5-en-3-yloxy)-1-propan-2-ylcyclohexane |
| SMILES | C=CCC(O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)C(C)C |
| InChI | InChI=1S/C17H32O/c1-7-8-16(13(4)5)18-17-11-14(6)9-10-15(17)12(2)3/h7,12-17H,1,8-11H2,2-6H3/t14-,15+,16?,17-/m1/s1 |
| InChIKey | ALKZYFLWFVCOQE-FCLJQHQZSA-N |
| XLogP | 5.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|