C17H34O2 — CID 91460729
2,4-dimethyl-1-(5-methyl-2-propan-2-ylcyclohexyl)oxypentan-1-ol (PubChem CID 91460729) has the molecular formula C17H34O2 and a molecular weight of 270.46 g/mol. Its IUPAC name is 2,4-dimethyl-1-(5-methyl-2-propan-2-ylcyclohexyl)oxypentan-1-ol.
| Compound Name | 2,4-dimethyl-1-(5-methyl-2-propan-2-ylcyclohexyl)oxypentan-1-ol |
|---|---|
| PubChem CID | 91460729 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | 2,4-dimethyl-1-(5-methyl-2-propan-2-ylcyclohexyl)oxypentan-1-ol |
| SMILES | CC(C)CC(C)C(O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C17H34O2/c1-11(2)9-14(6)17(18)19-16-10-13(5)7-8-15(16)12(3)4/h11-18H,7-10H2,1-6H3 |
| InChIKey | UMUCEFIQKPZBFN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|